C23H35NOSe — CID 10788261
(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(3-methylbut-2-enyl)-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10788261) has the molecular formula C23H35NOSe and a molecular weight of 420.50 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(3-methylbut-2-enyl)-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(3-methylbut-2-enyl)-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10788261 |
| Molecular Formula | C23H35NOSe |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(3-methylbut-2-enyl)-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CC(C)=CCN1[C@H](C[Se]c2ccccc2)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C23H35NOSe/c1-17(2)13-14-24-22(16-26-19-9-7-6-8-10-19)25-21-15-18(3)11-12-20(21)23(24,4)5/h6-10,13,18,20-22H,11-12,14-16H2,1-5H3/t18-,20-,21-,22+/m1/s1 |
| InChIKey | QNPVVCHVWDLNPW-NMIHRBCNSA-N |
| XLogP | 4.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|