C23H29N6O9PS2 — CID 10794040
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 10794040) has the molecular formula C23H29N6O9PS2 and a molecular weight of 628.63 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10794040 |
| Molecular Formula | C23H29N6O9PS2 |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(=O)OP(O)(=S)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H29N6O9PS2/c1-41-8-7-14(28-23(33)35-9-13-5-3-2-4-6-13)22(32)38-39(34,40)36-10-15-17(30)18(31)21(37-15)29-12-27-16-19(24)25-11-26-20(16)29/h2-6,11-12,14-15,17-18,21,30-31H,7-10H2,1H3,(H,28,33)(H,34,40)(H2,24,25,26)/t14-,15+,17+,18+,21+,39?/m0/s1 |
| InChIKey | NSFMHGMSODQJFZ-ZWIWCGPYSA-N |
| XLogP | 0.85 |
| TPSA | 213.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|