C39H44N4O11Zn — CID 10795493
zinc methyl 3-[8-hydroxy-7-methoxy-3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,12-tetramethyl-13-oxoporphyrin-22,24-diid-2-yl]propanoate (PubChem CID 10795493) has the molecular formula C39H44N4O11Zn and a molecular weight of 810.19 g/mol. Its IUPAC name is zinc methyl 3-[8-hydroxy-7-methoxy-3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,12-tetramethyl-13-oxoporphyrin-22,24-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[8-hydroxy-7-methoxy-3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,12-tetramethyl-13-oxoporphyrin-22,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 10795493 |
| Molecular Formula | C39H44N4O11Zn |
| Molecular Weight | 810.19 g/mol |
| Exact Mass | 808.23 |
| IUPAC Name | zinc methyl 3-[8-hydroxy-7-methoxy-3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,12-tetramethyl-13-oxoporphyrin-22,24-diid-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(CC(=O)OC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=O)OC)c5CC(=O)OC)C(=O)C4(C)C)C(C)(O)C3(C)OC.[Zn+2] |
| InChI | InChI=1S/C39H45N4O11.Zn/c1-37(2)29-19-30-38(3,49)39(4,54-9)31(43-30)18-27-23(15-35(47)53-8)21(11-13-33(45)51-6)25(41-27)16-24-20(10-12-32(44)50-5)22(14-34(46)52-7)26(40-24)17-28(42-29)36(37)48;/h16-19,49H,10-15H2,1-9H3,(H-,40,41,42,43,48);/q-1;+2/p-1 |
| InChIKey | AJGTZQLJFFUVOH-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 205.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|