C38H40N4O9Zn — CID 10842837
zinc methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-oxoporphyrin-22,24-diid-2-yl]propanoate (PubChem CID 10842837) has the molecular formula C38H40N4O9Zn and a molecular weight of 762.15 g/mol. Its IUPAC name is zinc methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-oxoporphyrin-22,24-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-oxoporphyrin-22,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 10842837 |
| Molecular Formula | C38H40N4O9Zn |
| Molecular Weight | 762.15 g/mol |
| Exact Mass | 760.21 |
| IUPAC Name | zinc methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-oxoporphyrin-22,24-diid-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(CC(=O)OC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CCC(=O)OC)c5CC(=O)OC)C(C)(C)C4=O)c(C)c3C.[Zn+2] |
| InChI | InChI=1S/C38H41N4O9.Zn/c1-19-20(2)26-16-31-37(47)38(3,4)32(42-31)18-30-24(14-36(46)51-8)22(10-12-34(44)49-6)28(41-30)17-27-21(9-11-33(43)48-5)23(13-35(45)50-7)29(40-27)15-25(19)39-26;/h15-18H,9-14H2,1-8H3,(H-,39,40,41,42,47);/q-1;+2/p-1 |
| InChIKey | VTSBUZVEDHOLBE-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 176.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|