C14H11Br2NO3S — CID 107962373
2,5-dibromo-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-3-carboxamide (PubChem CID 107962373) has the molecular formula C14H11Br2NO3S and a molecular weight of 433.12 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107962373 |
| Molecular Formula | C14H11Br2NO3S |
| Molecular Weight | 433.12 g/mol |
| Exact Mass | 430.88 |
| IUPAC Name | 2,5-dibromo-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2OCCO2)cc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H11Br2NO3S/c15-11-7-10(12(16)21-11)13(18)17-9-3-1-8(2-4-9)14-19-5-6-20-14/h1-4,7,14H,5-6H2,(H,17,18) |
| InChIKey | YFPMDMJWNQPWQX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.12 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |