C17H28O4 — CID 10827794
2-[2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-1,7-dioxaspiro[5.5]undec-4-ene (PubChem CID 10827794) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-1,7-dioxaspiro[5.5]undec-4-ene.
| Compound Name | 2-[2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-1,7-dioxaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 10827794 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[2-(2,2,4-trimethyl-1,3-dioxolan-4-yl)ethyl]-1,7-dioxaspiro[5.5]undec-4-ene |
| SMILES | CC1(CCC2CC=CC3(CCCCO3)O2)COC(C)(C)O1 |
| InChI | InChI=1S/C17H28O4/c1-15(2)19-13-16(3,21-15)11-8-14-7-6-10-17(20-14)9-4-5-12-18-17/h6,10,14H,4-5,7-9,11-13H2,1-3H3 |
| InChIKey | QPAFVCOITUSTMW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|