C19H30O6 — CID 130385939
(1R,2S,6R,7S)-2-[(Z)-8,8-dimethoxyoct-1-enyl]-4,4-dimethyl-3,5,8,9-tetraoxatricyclo[5.2.2.02,6]undec-10-ene (PubChem CID 130385939) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (1R,2S,6R,7S)-2-[(Z)-8,8-dimethoxyoct-1-enyl]-4,4-dimethyl-3,5,8,9-tetraoxatricyclo[5.2.2.02,6]undec-10-ene.
| Compound Name | (1R,2S,6R,7S)-2-[(Z)-8,8-dimethoxyoct-1-enyl]-4,4-dimethyl-3,5,8,9-tetraoxatricyclo[5.2.2.02,6]undec-10-ene |
|---|---|
| PubChem CID | 130385939 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1R,2S,6R,7S)-2-[(Z)-8,8-dimethoxyoct-1-enyl]-4,4-dimethyl-3,5,8,9-tetraoxatricyclo[5.2.2.02,6]undec-10-ene |
| SMILES | COC(CCCCC/C=C\[C@]12OC(C)(C)O[C@@H]1[C@@H]1C=C[C@H]2OO1)OC |
| InChI | InChI=1S/C19H30O6/c1-18(2)22-17-14-11-12-15(24-23-14)19(17,25-18)13-9-7-5-6-8-10-16(20-3)21-4/h9,11-17H,5-8,10H2,1-4H3/b13-9-/t14-,15+,17+,19+/m0/s1 |
| InChIKey | SBZYXFSLNJTTCO-FPEBOCRZSA-N |
| XLogP | 3.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|