C31H36N2O2S — CID 10839120
7-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile (PubChem CID 10839120) has the molecular formula C31H36N2O2S and a molecular weight of 500.71 g/mol. Its IUPAC name is 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile.
| Compound Name | 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
|---|---|
| PubChem CID | 10839120 |
| Molecular Formula | C31H36N2O2S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCN2CCc3ccccc3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C31H36N2O2S/c1-24-11-14-28(15-12-24)36-31(23-32,27-13-16-29(34-2)30(21-27)35-3)18-7-4-8-19-33-20-17-25-9-5-6-10-26(25)22-33/h5-6,9-16,21H,4,7-8,17-20,22H2,1-3H3 |
| InChIKey | GXJHUAZBKIYVKG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|