C14H23ClN4OSi — CID 10853618
5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 10853618) has the molecular formula C14H23ClN4OSi and a molecular weight of 326.90 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10853618 |
| Molecular Formula | C14H23ClN4OSi |
| Molecular Weight | 326.90 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1c[nH]c2nc(N)nc(Cl)c12 |
| InChI | InChI=1S/C14H23ClN4OSi/c1-14(2,3)21(4,5)20-7-6-9-8-17-12-10(9)11(15)18-13(16)19-12/h8H,6-7H2,1-5H3,(H3,16,17,18,19) |
| InChIKey | XSHUTTSWBUGIHM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|