C24H31F3O6SSi — CID 10864402
tert-butyl-dimethyl-[2-[(E)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylprop-2-enoxy]ethoxy]silane (PubChem CID 10864402) has the molecular formula C24H31F3O6SSi and a molecular weight of 532.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[(E)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylprop-2-enoxy]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[(E)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylprop-2-enoxy]ethoxy]silane |
|---|---|
| PubChem CID | 10864402 |
| Molecular Formula | C24H31F3O6SSi |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | tert-butyl-dimethyl-[2-[(E)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylprop-2-enoxy]ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOC/C=C/S(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H31F3O6SSi/c1-23(2,3)35(4,5)31-17-16-30-15-6-18-34(28,29)22-13-11-20(12-14-22)32-19-7-9-21(10-8-19)33-24(25,26)27/h6-14,18H,15-17H2,1-5H3/b18-6+ |
| InChIKey | LYRDQCGUOCGNOG-NGYBGAFCSA-N |
| XLogP | 6.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|