C37H40O7SSe — CID 10876261
Se-phenyl (4S,5S)-4-[(Z)-2-(benzenesulfonyl)ethenoxy]-8-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoctaneselenoate (PubChem CID 10876261) has the molecular formula C37H40O7SSe and a molecular weight of 707.75 g/mol. Its IUPAC name is Se-phenyl (4S,5S)-4-[(Z)-2-(benzenesulfonyl)ethenoxy]-8-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoctaneselenoate.
| Compound Name | Se-phenyl (4S,5S)-4-[(Z)-2-(benzenesulfonyl)ethenoxy]-8-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoctaneselenoate |
|---|---|
| PubChem CID | 10876261 |
| Molecular Formula | C37H40O7SSe |
| Molecular Weight | 707.75 g/mol |
| Exact Mass | 708.17 |
| IUPAC Name | Se-phenyl (4S,5S)-4-[(Z)-2-(benzenesulfonyl)ethenoxy]-8-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoctaneselenoate |
| SMILES | COc1ccc(COCCC[C@H](OCc2ccccc2)[C@H](CCC(=O)[Se]c2ccccc2)O/C=C\S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H40O7SSe/c1-41-32-21-19-31(20-22-32)28-42-25-11-18-35(44-29-30-12-5-2-6-13-30)36(23-24-37(38)46-34-16-9-4-10-17-34)43-26-27-45(39,40)33-14-7-3-8-15-33/h2-10,12-17,19-22,26-27,35-36H,11,18,23-25,28-29H2,1H3/b27-26-/t35-,36-/m0/s1 |
| InChIKey | QXIHYOXFARJPJZ-KWNHOTCJSA-N |
| XLogP | 6.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.75 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|