C17H20O5 — CID 10913729
3-[(4R,5S)-5-[1-(1,3-benzodioxol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanal (PubChem CID 10913729) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-[(4R,5S)-5-[1-(1,3-benzodioxol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanal.
| Compound Name | 3-[(4R,5S)-5-[1-(1,3-benzodioxol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanal |
|---|---|
| PubChem CID | 10913729 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-[(4R,5S)-5-[1-(1,3-benzodioxol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanal |
| SMILES | C=C(c1ccc2c(c1)OCO2)[C@@H]1OC(C)(C)O[C@@H]1CCC=O |
| InChI | InChI=1S/C17H20O5/c1-11(12-6-7-13-15(9-12)20-10-19-13)16-14(5-4-8-18)21-17(2,3)22-16/h6-9,14,16H,1,4-5,10H2,2-3H3/t14-,16+/m1/s1 |
| InChIKey | PSZUAGAISUZWSU-ZBFHGGJFSA-N |
| XLogP | 2.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|