C22H26FN3O2S — CID 109445639
1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 109445639) has the molecular formula C22H26FN3O2S and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109445639 |
| Molecular Formula | C22H26FN3O2S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc(F)ccc1CS(C)(=O)=O)NCC1C2Cc3ccccc3C12 |
| InChI | InChI=1S/C22H26FN3O2S/c1-24-22(25-11-16-9-17(23)8-7-15(16)13-29(2,27)28)26-12-20-19-10-14-5-3-4-6-18(14)21(19)20/h3-9,19-21H,10-13H2,1-2H3,(H2,24,25,26) |
| InChIKey | DGGKFNPWVTWMGA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|