C12H21F3IN5O2S — CID 109473302
2-methyl-1-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473302) has the molecular formula C12H21F3IN5O2S and a molecular weight of 483.30 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473302 |
| Molecular Formula | C12H21F3IN5O2S |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-methyl-1-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1ccn(C)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C12H20F3N5O2S.HI/c1-16-11(17-5-4-12(13,14)15)18-6-7-19-23(21,22)10-3-8-20(2)9-10;/h3,8-9,19H,4-7H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | DDMPRIOAIUPLBA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|