C30H36O6SSi — CID 10951787
(3R,3aR,5S,7S,7aS)-7-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-ol (PubChem CID 10951787) has the molecular formula C30H36O6SSi and a molecular weight of 552.77 g/mol. Its IUPAC name is (3R,3aR,5S,7S,7aS)-7-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-ol.
| Compound Name | (3R,3aR,5S,7S,7aS)-7-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-ol |
|---|---|
| PubChem CID | 10951787 |
| Molecular Formula | C30H36O6SSi |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (3R,3aR,5S,7S,7aS)-7-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@H](S(=O)(=O)c2ccccc2)[C@H]2OC[C@@H](O)[C@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O6SSi/c1-30(2,3)38(24-15-9-5-10-16-24,25-17-11-6-12-18-25)35-20-22-19-27(29-28(36-22)26(31)21-34-29)37(32,33)23-13-7-4-8-14-23/h4-18,22,26-29,31H,19-21H2,1-3H3/t22-,26+,27-,28+,29+/m0/s1 |
| InChIKey | URSXHMPJPADLQR-CTWGYRKFSA-N |
| XLogP | 3.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|