C17H18BNO4 — CID 11001424
(4S,6S)-4-ethyl-6-(4-nitrophenyl)-2-phenyl-1,3,2-dioxaborinane (PubChem CID 11001424) has the molecular formula C17H18BNO4 and a molecular weight of 311.15 g/mol. Its IUPAC name is (4S,6S)-4-ethyl-6-(4-nitrophenyl)-2-phenyl-1,3,2-dioxaborinane.
| Compound Name | (4S,6S)-4-ethyl-6-(4-nitrophenyl)-2-phenyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 11001424 |
| Molecular Formula | C17H18BNO4 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4S,6S)-4-ethyl-6-(4-nitrophenyl)-2-phenyl-1,3,2-dioxaborinane |
| SMILES | CC[C@H]1C[C@@H](c2ccc([N+](=O)[O-])cc2)OB(c2ccccc2)O1 |
| InChI | InChI=1S/C17H18BNO4/c1-2-16-12-17(13-8-10-15(11-9-13)19(20)21)23-18(22-16)14-6-4-3-5-7-14/h3-11,16-17H,2,12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | TWUWBXCWFGVWAU-IRXDYDNUSA-N |
| XLogP | 3.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|