C14H17Cl2NO3 — CID 177474556
(2S,3S,4R,6S)-4-chloro-3-(chloromethyl)-6-ethyl-2-(4-nitrophenyl)oxane (PubChem CID 177474556) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (2S,3S,4R,6S)-4-chloro-3-(chloromethyl)-6-ethyl-2-(4-nitrophenyl)oxane.
| Compound Name | (2S,3S,4R,6S)-4-chloro-3-(chloromethyl)-6-ethyl-2-(4-nitrophenyl)oxane |
|---|---|
| PubChem CID | 177474556 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2S,3S,4R,6S)-4-chloro-3-(chloromethyl)-6-ethyl-2-(4-nitrophenyl)oxane |
| SMILES | CC[C@H]1C[C@@H](Cl)[C@H](CCl)[C@@H](c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C14H17Cl2NO3/c1-2-11-7-13(16)12(8-15)14(20-11)9-3-5-10(6-4-9)17(18)19/h3-6,11-14H,2,7-8H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | PVBSCINMQVDQKP-IGQOVBAYSA-N |
| XLogP | 4.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|