C34H40ClNO4 — CID 11006240
(2S,3S,4R,5R)-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-3,5-diphenylpyrrolidin-1-ium-2-carboxylic acid chloride (PubChem CID 11006240) has the molecular formula C34H40ClNO4 and a molecular weight of 562.15 g/mol. Its IUPAC name is (2S,3S,4R,5R)-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-3,5-diphenylpyrrolidin-1-ium-2-carboxylic acid chloride.
| Compound Name | (2S,3S,4R,5R)-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-3,5-diphenylpyrrolidin-1-ium-2-carboxylic acid chloride |
|---|---|
| PubChem CID | 11006240 |
| Molecular Formula | C34H40ClNO4 |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | (2S,3S,4R,5R)-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-3,5-diphenylpyrrolidin-1-ium-2-carboxylic acid chloride |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)[C@@H]2[C@@H](c3ccccc3)[C@@H](C(=O)O)[NH2+][C@H]2c2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C34H39NO4.ClH/c1-22-19-20-26(34(2,3)25-17-11-6-12-18-25)27(21-22)39-33(38)29-28(23-13-7-4-8-14-23)31(32(36)37)35-30(29)24-15-9-5-10-16-24;/h4-18,22,26-31,35H,19-21H2,1-3H3,(H,36,37);1H/t22-,26-,27-,28-,29-,30+,31+;/m1./s1 |
| InChIKey | XTPWJIFPUOSJDE-LLWKXUHOSA-N |
| XLogP | 2.49 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |