C23H30N4O4S — CID 110067308
9-(4-methylsulfonylpiperazin-1-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaene (PubChem CID 110067308) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 9-(4-methylsulfonylpiperazin-1-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaene.
| Compound Name | 9-(4-methylsulfonylpiperazin-1-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaene |
|---|---|
| PubChem CID | 110067308 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 9-(4-methylsulfonylpiperazin-1-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaene |
| SMILES | CS(=O)(=O)N1CCN(/C2=N\CCCCCCOc3ccccc3Oc3ncccc32)CC1 |
| InChI | InChI=1S/C23H30N4O4S/c1-32(28,29)27-16-14-26(15-17-27)22-19-9-8-13-25-23(19)31-21-11-5-4-10-20(21)30-18-7-3-2-6-12-24-22/h4-5,8-11,13H,2-3,6-7,12,14-18H2,1H3/b24-22- |
| InChIKey | CSVRYEFRELPGAZ-GYHWCHFESA-N |
| XLogP | 3.15 |
| TPSA | 84.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |