C20H24N2O7S2 — CID 110166858
4-methoxy-N-(4-methylsulfonylphenyl)sulfonyl-3-(morpholin-4-ylmethyl)benzamide (PubChem CID 110166858) has the molecular formula C20H24N2O7S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-methoxy-N-(4-methylsulfonylphenyl)sulfonyl-3-(morpholin-4-ylmethyl)benzamide.
| Compound Name | 4-methoxy-N-(4-methylsulfonylphenyl)sulfonyl-3-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110166858 |
| Molecular Formula | C20H24N2O7S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-methoxy-N-(4-methylsulfonylphenyl)sulfonyl-3-(morpholin-4-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C20H24N2O7S2/c1-28-19-8-3-15(13-16(19)14-22-9-11-29-12-10-22)20(23)21-31(26,27)18-6-4-17(5-7-18)30(2,24)25/h3-8,13H,9-12,14H2,1-2H3,(H,21,23) |
| InChIKey | QYYHLHIZIMXVOZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |