C13H11NO3 — CID 11020667
2-oxo-5,6-dihydro-3H-benzo[h][1,4]benzoxazine-4-carbaldehyde (PubChem CID 11020667) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-oxo-5,6-dihydro-3H-benzo[h][1,4]benzoxazine-4-carbaldehyde.
| Compound Name | 2-oxo-5,6-dihydro-3H-benzo[h][1,4]benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 11020667 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-oxo-5,6-dihydro-3H-benzo[h][1,4]benzoxazine-4-carbaldehyde |
| SMILES | O=CN1CC(=O)OC2=C1CCc1ccccc12 |
| InChI | InChI=1S/C13H11NO3/c15-8-14-7-12(16)17-13-10-4-2-1-3-9(10)5-6-11(13)14/h1-4,8H,5-7H2 |
| InChIKey | ZQXOIVTZQOAHFF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|