C20H18OSi — CID 11023217
1,2,3,4,5-pentadeuterio-6-trimethylsilylbenzo[c]fluoren-7-one (PubChem CID 11023217) has the molecular formula C20H18OSi and a molecular weight of 307.48 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-trimethylsilylbenzo[c]fluoren-7-one.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-trimethylsilylbenzo[c]fluoren-7-one |
|---|---|
| PubChem CID | 11023217 |
| Molecular Formula | C20H18OSi |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-trimethylsilylbenzo[c]fluoren-7-one |
| SMILES | [2H]c1c([2H])c([2H])c2c3c(c([Si](C)(C)C)c([2H])c2c1[2H])C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C20H18OSi/c1-22(2,3)17-12-13-8-4-5-9-14(13)18-15-10-6-7-11-16(15)20(21)19(17)18/h4-12H,1-3H3/i4D,5D,8D,9D,12D |
| InChIKey | YKSJWDYGHMSDNE-CXJUJRHCSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|