C8H9N5O3S2 — CID 110384620
N-(1,1-dioxothiolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110384620) has the molecular formula C8H9N5O3S2 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110384620 |
| Molecular Formula | C8H9N5O3S2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1nn2cnnc2s1 |
| InChI | InChI=1S/C8H9N5O3S2/c14-6(10-5-1-2-18(15,16)3-5)7-12-13-4-9-11-8(13)17-7/h4-5H,1-3H2,(H,10,14) |
| InChIKey | PEQGKEJGEDVKIF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |