C25H48O4SiSn — CID 11038993
2,2-dimethyl-6-[(E,2S)-4-tributylstannyl-2-trimethylsilyloxybut-3-enyl]-1,3-dioxin-4-one (PubChem CID 11038993) has the molecular formula C25H48O4SiSn and a molecular weight of 559.45 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(E,2S)-4-tributylstannyl-2-trimethylsilyloxybut-3-enyl]-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-[(E,2S)-4-tributylstannyl-2-trimethylsilyloxybut-3-enyl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11038993 |
| Molecular Formula | C25H48O4SiSn |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2,2-dimethyl-6-[(E,2S)-4-tributylstannyl-2-trimethylsilyloxybut-3-enyl]-1,3-dioxin-4-one |
| SMILES | CCCC[Sn](/C=C/[C@H](CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C13H21O4Si.3C4H9.Sn/c1-7-10(17-18(4,5)6)8-11-9-12(14)16-13(2,3)15-11;3*1-3-4-2;/h1,7,9-10H,8H2,2-6H3;3*1,3-4H2,2H3;/t10-;;;;/m1..../s1 |
| InChIKey | XVIGOPTWNWVJJD-USOZLSCGSA-N |
| XLogP | 7.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|