C40H66O7Si2 — CID 11039842
[(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R,5S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-5-methoxyoxolan-2-yl]-4-hydroxybutyl] 2,2-dimethylpropanoate (PubChem CID 11039842) has the molecular formula C40H66O7Si2 and a molecular weight of 715.13 g/mol. Its IUPAC name is [(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R,5S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-5-methoxyoxolan-2-yl]-4-hydroxybutyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R,5S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-5-methoxyoxolan-2-yl]-4-hydroxybutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11039842 |
| Molecular Formula | C40H66O7Si2 |
| Molecular Weight | 715.13 g/mol |
| Exact Mass | 714.43 |
| IUPAC Name | [(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R,5S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-5-methoxyoxolan-2-yl]-4-hydroxybutyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1C[C@@H](C[C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]([C@@H](O)[C@@H](CCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C40H66O7Si2/c1-29(28-45-49(40(8,9)10,31-20-16-14-17-21-31)32-22-18-15-19-23-32)26-30-27-34(43-11)46-36(30)35(41)33(47-48(12,13)39(5,6)7)24-25-44-37(42)38(2,3)4/h14-23,29-30,33-36,41H,24-28H2,1-13H3/t29-,30-,33-,34+,35+,36+/m1/s1 |
| InChIKey | LDHNFSNXSZJUIJ-UXUFOGPWSA-N |
| XLogP | 7.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.13 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|