C36H58O5Si2 — CID 134937013
(2R,5S,7R,9R,10S)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methyl-9-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-10-ol (PubChem CID 134937013) has the molecular formula C36H58O5Si2 and a molecular weight of 627.03 g/mol. Its IUPAC name is (2R,5S,7R,9R,10S)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methyl-9-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-10-ol.
| Compound Name | (2R,5S,7R,9R,10S)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methyl-9-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-10-ol |
|---|---|
| PubChem CID | 134937013 |
| Molecular Formula | C36H58O5Si2 |
| Molecular Weight | 627.03 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | (2R,5S,7R,9R,10S)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methyl-9-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-10-ol |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@]2(CC[C@@H](C)O2)[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H58O5Si2/c1-26(2)42(27(3)4,28(5)6)41-33-25-30(40-36(34(33)37)23-21-29(7)39-36)22-24-38-43(35(8,9)10,31-17-13-11-14-18-31)32-19-15-12-16-20-32/h11-20,26-30,33-34,37H,21-25H2,1-10H3/t29-,30-,33-,34+,36+/m1/s1 |
| InChIKey | QBBPERRYKHHPSS-DKCXPUCYSA-N |
| XLogP | 7.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.03 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|