C39H43Cl2NP2RuS — CID 11040067
N,N-bis(2-diphenylphosphanylethyl)propan-1-amine;dichlororuthenium;2-phenylethanethial (PubChem CID 11040067) has the molecular formula C39H43Cl2NP2RuS and a molecular weight of 791.77 g/mol. Its IUPAC name is N,N-bis(2-diphenylphosphanylethyl)propan-1-amine;dichlororuthenium;2-phenylethanethial.
| Compound Name | N,N-bis(2-diphenylphosphanylethyl)propan-1-amine;dichlororuthenium;2-phenylethanethial |
|---|---|
| PubChem CID | 11040067 |
| Molecular Formula | C39H43Cl2NP2RuS |
| Molecular Weight | 791.77 g/mol |
| Exact Mass | 791.10 |
| IUPAC Name | N,N-bis(2-diphenylphosphanylethyl)propan-1-amine;dichlororuthenium;2-phenylethanethial |
| SMILES | CCCN(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1.Cl[Ru]Cl.S=CCc1ccccc1 |
| InChI | InChI=1S/C31H35NP2.C8H8S.2ClH.Ru/c1-2-23-32(24-26-33(28-15-7-3-8-16-28)29-17-9-4-10-18-29)25-27-34(30-19-11-5-12-20-30)31-21-13-6-14-22-31;9-7-6-8-4-2-1-3-5-8;;;/h3-22H,2,23-27H2,1H3;1-5,7H,6H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | VSEJDBBERGURCP-UHFFFAOYSA-L |
| XLogP | 9.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.77 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|