C32H48O3Si2 — CID 11049790
tert-butyl-dimethyl-[[(1R,6S,8S,10R,11S)-10-(2-phenylethynyl)-11-prop-2-enyl-10-trimethylsilyloxy-12-oxatricyclo[6.3.1.01,6]dodec-4-en-8-yl]methoxy]silane (PubChem CID 11049790) has the molecular formula C32H48O3Si2 and a molecular weight of 536.91 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,6S,8S,10R,11S)-10-(2-phenylethynyl)-11-prop-2-enyl-10-trimethylsilyloxy-12-oxatricyclo[6.3.1.01,6]dodec-4-en-8-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,6S,8S,10R,11S)-10-(2-phenylethynyl)-11-prop-2-enyl-10-trimethylsilyloxy-12-oxatricyclo[6.3.1.01,6]dodec-4-en-8-yl]methoxy]silane |
|---|---|
| PubChem CID | 11049790 |
| Molecular Formula | C32H48O3Si2 |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,6S,8S,10R,11S)-10-(2-phenylethynyl)-11-prop-2-enyl-10-trimethylsilyloxy-12-oxatricyclo[6.3.1.01,6]dodec-4-en-8-yl]methoxy]silane |
| SMILES | C=CC[C@H]1[C@@]23CCC=C[C@@H]2C[C@@](CO[Si](C)(C)C(C)(C)C)(C[C@@]1(C#Cc1ccccc1)O[Si](C)(C)C)O3 |
| InChI | InChI=1S/C32H48O3Si2/c1-10-16-28-31(35-36(5,6)7,22-20-26-17-12-11-13-18-26)24-30(25-33-37(8,9)29(2,3)4)23-27-19-14-15-21-32(27,28)34-30/h10-14,17-19,27-28H,1,15-16,21,23-25H2,2-9H3/t27-,28-,30+,31-,32-/m1/s1 |
| InChIKey | QYSCSNGNRTXMEI-HEUDMROTSA-N |
| XLogP | 8.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|