C9H17NO5S — CID 110678224
N-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethoxy)-N-methylacetamide (PubChem CID 110678224) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethoxy)-N-methylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 110678224 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-hydroxyethoxy)-N-methylacetamide |
| SMILES | CN(C(=O)COCCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO5S/c1-10(9(12)6-15-4-3-11)8-2-5-16(13,14)7-8/h8,11H,2-7H2,1H3 |
| InChIKey | LDWXNLIWRYUBAQ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|