C13H14O3 — CID 11074844
(1'R,2'R,6'S,7'R)-7'-methoxyspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one (PubChem CID 11074844) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1'R,2'R,6'S,7'R)-7'-methoxyspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one.
| Compound Name | (1'R,2'R,6'S,7'R)-7'-methoxyspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
|---|---|
| PubChem CID | 11074844 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1'R,2'R,6'S,7'R)-7'-methoxyspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
| SMILES | CO[C@]12C=C[C@H]([C@@H]3CC=C[C@@H]31)C1(CO1)C2=O |
| InChI | InChI=1S/C13H14O3/c1-15-12-6-5-10(8-3-2-4-9(8)12)13(7-16-13)11(12)14/h2,4-6,8-10H,3,7H2,1H3/t8-,9+,10-,12-,13?/m1/s1 |
| InChIKey | MZADHLXWGZADFD-FSSLKIHNSA-N |
| XLogP | 1.10 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|