C16H11Cl2N3OS — CID 11079014
5-[4-(2,4-dichlorophenyl)phenyl]-3-methylsulfinyl-1,2,4-triazine (PubChem CID 11079014) has the molecular formula C16H11Cl2N3OS and a molecular weight of 364.26 g/mol. Its IUPAC name is 5-[4-(2,4-dichlorophenyl)phenyl]-3-methylsulfinyl-1,2,4-triazine.
| Compound Name | 5-[4-(2,4-dichlorophenyl)phenyl]-3-methylsulfinyl-1,2,4-triazine |
|---|---|
| PubChem CID | 11079014 |
| Molecular Formula | C16H11Cl2N3OS |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 5-[4-(2,4-dichlorophenyl)phenyl]-3-methylsulfinyl-1,2,4-triazine |
| SMILES | CS(=O)c1nncc(-c2ccc(-c3ccc(Cl)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C16H11Cl2N3OS/c1-23(22)16-20-15(9-19-21-16)11-4-2-10(3-5-11)13-7-6-12(17)8-14(13)18/h2-9H,1H3 |
| InChIKey | PCKKEVWUDYHVDH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |