C9H6F8O2 — CID 11098531
(1R,2S,6R,7S)-3,3,5,5,8,8,10,10-octafluoro-4,9-dioxatricyclo[5.3.1.02,6]undecane (PubChem CID 11098531) has the molecular formula C9H6F8O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is (1R,2S,6R,7S)-3,3,5,5,8,8,10,10-octafluoro-4,9-dioxatricyclo[5.3.1.02,6]undecane.
| Compound Name | (1R,2S,6R,7S)-3,3,5,5,8,8,10,10-octafluoro-4,9-dioxatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 11098531 |
| Molecular Formula | C9H6F8O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (1R,2S,6R,7S)-3,3,5,5,8,8,10,10-octafluoro-4,9-dioxatricyclo[5.3.1.02,6]undecane |
| SMILES | FC1(F)OC(F)(F)[C@H]2[C@@H]1[C@H]1C[C@@H]2C(F)(F)OC1(F)F |
| InChI | InChI=1S/C9H6F8O2/c10-6(11)2-1-3(7(12,13)18-6)5-4(2)8(14,15)19-9(5,16)17/h2-5H,1H2/t2-,3+,4+,5- |
| InChIKey | BLNGJTPOIQQONF-YPVPKEFPSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |