C21H28N6O2S — CID 111075293
2-[4-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide (PubChem CID 111075293) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-[4-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 111075293 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[4-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
| SMILES | N/C(=N\CCc1ccc(OCC(=O)NC2CC2)cc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C21H28N6O2S/c22-20(26-10-12-27(13-11-26)21-24-9-14-30-21)23-8-7-16-1-5-18(6-2-16)29-15-19(28)25-17-3-4-17/h1-2,5-6,9,14,17H,3-4,7-8,10-13,15H2,(H2,22,23)(H,25,28) |
| InChIKey | MZEKIYDOMCLUJW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|