C38H60O5Si2 — CID 11114968
(1S,8R,9R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-one (PubChem CID 11114968) has the molecular formula C38H60O5Si2 and a molecular weight of 653.07 g/mol. Its IUPAC name is (1S,8R,9R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-one.
| Compound Name | (1S,8R,9R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-one |
|---|---|
| PubChem CID | 11114968 |
| Molecular Formula | C38H60O5Si2 |
| Molecular Weight | 653.07 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | (1S,8R,9R)-5-[tert-butyl(dimethyl)silyl]-8-[tert-butyl(dimethyl)silyl]oxy-11-[6-[(4-methoxyphenyl)methoxy]hexyl]-4-oxatricyclo[7.3.1.02,6]trideca-2,5,11-trien-13-one |
| SMILES | COc1ccc(COCCCCCCC2=C[C@@H]3C(=O)[C@H](C2)[C@H](O[Si](C)(C)C(C)(C)C)Cc2c3coc2[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C38H60O5Si2/c1-37(2,3)44(8,9)36-31-24-34(43-45(10,11)38(4,5)6)32-23-28(22-30(35(32)39)33(31)26-42-36)16-14-12-13-15-21-41-25-27-17-19-29(40-7)20-18-27/h17-20,22,26,30,32,34H,12-16,21,23-25H2,1-11H3/t30-,32+,34+/m0/s1 |
| InChIKey | HRIICGMZSHALNP-DEIXXNFJSA-N |
| XLogP | 9.72 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.07 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|