C38H61IO5Si2 — CID 11115408
(4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one (PubChem CID 11115408) has the molecular formula C38H61IO5Si2 and a molecular weight of 780.98 g/mol. Its IUPAC name is (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one.
| Compound Name | (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11115408 |
| Molecular Formula | C38H61IO5Si2 |
| Molecular Weight | 780.98 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one |
| SMILES | COc1ccc(COCCCCCC[C@@H]2C=CC(=O)[C@@H]([C@@H](Cc3c(I)coc3[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C38H61IO5Si2/c1-37(2,3)45(8,9)36-31(33(39)27-43-36)25-35(44-46(10,11)38(4,5)6)32-24-28(19-22-34(32)40)16-14-12-13-15-23-42-26-29-17-20-30(41-7)21-18-29/h17-22,27-28,32,35H,12-16,23-26H2,1-11H3/t28-,32+,35-/m1/s1 |
| InChIKey | YJNKFJOXNMJVAP-DTSBFXBYSA-N |
| XLogP | 10.47 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.98 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|