C23H32O7 — CID 11133564
(1S,4R,9R,10R,12R)-4-(2-methoxyethoxymethoxy)-12-[(4-methoxyphenyl)methoxy]-11-oxatricyclo[7.2.1.05,10]dodec-5-en-1-ol (PubChem CID 11133564) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is (1S,4R,9R,10R,12R)-4-(2-methoxyethoxymethoxy)-12-[(4-methoxyphenyl)methoxy]-11-oxatricyclo[7.2.1.05,10]dodec-5-en-1-ol.
| Compound Name | (1S,4R,9R,10R,12R)-4-(2-methoxyethoxymethoxy)-12-[(4-methoxyphenyl)methoxy]-11-oxatricyclo[7.2.1.05,10]dodec-5-en-1-ol |
|---|---|
| PubChem CID | 11133564 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (1S,4R,9R,10R,12R)-4-(2-methoxyethoxymethoxy)-12-[(4-methoxyphenyl)methoxy]-11-oxatricyclo[7.2.1.05,10]dodec-5-en-1-ol |
| SMILES | COCCOCO[C@@H]1CC[C@]2(O)O[C@H]3C1=CCC[C@H]3[C@H]2OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H32O7/c1-25-12-13-27-15-29-20-10-11-23(24)22(19-5-3-4-18(20)21(19)30-23)28-14-16-6-8-17(26-2)9-7-16/h4,6-9,19-22,24H,3,5,10-15H2,1-2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | NUAQROUBJJXOMV-ZQGJOIPISA-N |
| XLogP | 2.80 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|