C21H26O6 — CID 10894075
methyl (1S,3R,8R,9R,11R)-1-methoxy-11-[(4-methoxyphenyl)methoxy]-10-oxatricyclo[6.2.1.04,9]undec-4-ene-3-carboxylate (PubChem CID 10894075) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is methyl (1S,3R,8R,9R,11R)-1-methoxy-11-[(4-methoxyphenyl)methoxy]-10-oxatricyclo[6.2.1.04,9]undec-4-ene-3-carboxylate.
| Compound Name | methyl (1S,3R,8R,9R,11R)-1-methoxy-11-[(4-methoxyphenyl)methoxy]-10-oxatricyclo[6.2.1.04,9]undec-4-ene-3-carboxylate |
|---|---|
| PubChem CID | 10894075 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl (1S,3R,8R,9R,11R)-1-methoxy-11-[(4-methoxyphenyl)methoxy]-10-oxatricyclo[6.2.1.04,9]undec-4-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(OC)O[C@H]3C1=CCC[C@H]3[C@H]2OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26O6/c1-23-14-9-7-13(8-10-14)12-26-19-16-6-4-5-15-17(20(22)24-2)11-21(19,25-3)27-18(15)16/h5,7-10,16-19H,4,6,11-12H2,1-3H3/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | QLDPROSBXNYNIT-YRIDSSQKSA-N |
| XLogP | 2.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|