C26H52O4Si — CID 11144927
tert-butyl-[(E,2R,3R,4R,5S)-1-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl]oxy-dimethylsilane (PubChem CID 11144927) has the molecular formula C26H52O4Si and a molecular weight of 456.78 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R,4R,5S)-1-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R,4R,5S)-1-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11144927 |
| Molecular Formula | C26H52O4Si |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | tert-butyl-[(E,2R,3R,4R,5S)-1-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl]oxy-dimethylsilane |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@H]1OC(C)(C)OC[C@H]1CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si/c1-13-15-16-19(3)24(27-10)20(4)22(30-31(11,12)25(5,6)7)17-23-21(14-2)18-28-26(8,9)29-23/h13,15,19-24H,14,16-18H2,1-12H3/b15-13+/t19-,20-,21+,22+,23+,24+/m0/s1 |
| InChIKey | USECSZQQWPTIGQ-SSWGLEMQSA-N |
| XLogP | 7.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|