C33H62O4Si2 — CID 134982986
[(7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]oxy-triethylsilane (PubChem CID 134982986) has the molecular formula C33H62O4Si2 and a molecular weight of 579.03 g/mol. Its IUPAC name is [(7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]oxy-triethylsilane.
| Compound Name | [(7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134982986 |
| Molecular Formula | C33H62O4Si2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | [(7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1C[C@@H](CC[C@@H]2[C@@H]3C(=CCCC3O[Si](CC)(CC)CC)C=C[C@@H]2C)OC(C)(C)O1 |
| InChI | InChI=1S/C33H62O4Si2/c1-10-38(11-2,12-3)34-24-23-29-25-28(35-33(8,9)36-29)21-22-30-26(7)19-20-27-17-16-18-31(32(27)30)37-39(13-4,14-5)15-6/h17,19-20,26,28-32H,10-16,18,21-25H2,1-9H3/t26-,28+,29-,30-,31?,32-/m0/s1 |
| InChIKey | XFKNOIKHRRSGNR-KBQBGDBLSA-N |
| XLogP | 9.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|