C25H44O3Si — CID 11154376
(1S,3R,3aR,4S,5R,7aR)-7-methyl-3,4-bis(prop-1-en-2-yl)-1-[tri(propan-2-yl)silyloxymethyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-ol (PubChem CID 11154376) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (1S,3R,3aR,4S,5R,7aR)-7-methyl-3,4-bis(prop-1-en-2-yl)-1-[tri(propan-2-yl)silyloxymethyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-ol.
| Compound Name | (1S,3R,3aR,4S,5R,7aR)-7-methyl-3,4-bis(prop-1-en-2-yl)-1-[tri(propan-2-yl)silyloxymethyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 11154376 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (1S,3R,3aR,4S,5R,7aR)-7-methyl-3,4-bis(prop-1-en-2-yl)-1-[tri(propan-2-yl)silyloxymethyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-ol |
| SMILES | C=C(C)[C@@H]1[C@@H]2[C@H](C(C)=C[C@H]1O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[C@H]2C(=C)C |
| InChI | InChI=1S/C25H44O3Si/c1-14(2)22-20(26)12-19(11)23-21(28-25(15(3)4)24(22)23)13-27-29(16(5)6,17(7)8)18(9)10/h12,16-18,20-26H,1,3,13H2,2,4-11H3/t20-,21-,22+,23-,24-,25+/m1/s1 |
| InChIKey | ICUDWCJYLJKSMP-YHYVJRSVSA-N |
| XLogP | 6.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|