C19H24Br2O2 — CID 11154990
[(1S,2R)-2-[(1R)-2,2-dibromo-1-buta-2,3-dienoxypropoxy]cyclohexyl]benzene (PubChem CID 11154990) has the molecular formula C19H24Br2O2 and a molecular weight of 444.21 g/mol. Its IUPAC name is [(1S,2R)-2-[(1R)-2,2-dibromo-1-buta-2,3-dienoxypropoxy]cyclohexyl]benzene.
| Compound Name | [(1S,2R)-2-[(1R)-2,2-dibromo-1-buta-2,3-dienoxypropoxy]cyclohexyl]benzene |
|---|---|
| PubChem CID | 11154990 |
| Molecular Formula | C19H24Br2O2 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | [(1S,2R)-2-[(1R)-2,2-dibromo-1-buta-2,3-dienoxypropoxy]cyclohexyl]benzene |
| SMILES | C=C=CCOC(O[C@@H]1CCCC[C@H]1c1ccccc1)C(C)(Br)Br |
| InChI | InChI=1S/C19H24Br2O2/c1-3-4-14-22-18(19(2,20)21)23-17-13-9-8-12-16(17)15-10-6-5-7-11-15/h4-7,10-11,16-18H,1,8-9,12-14H2,2H3/t16-,17+,18?/m0/s1 |
| InChIKey | XYZACBBXSNBJIK-MYFVLZFPSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|