C40H72O6Si2 — CID 11158327
(2R,5S,8S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2S,6R)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylideneoxan-2-yl]-5-methyl-4-methylidenedecan-2-ol (PubChem CID 11158327) has the molecular formula C40H72O6Si2 and a molecular weight of 705.18 g/mol. Its IUPAC name is (2R,5S,8S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2S,6R)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylideneoxan-2-yl]-5-methyl-4-methylidenedecan-2-ol.
| Compound Name | (2R,5S,8S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2S,6R)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylideneoxan-2-yl]-5-methyl-4-methylidenedecan-2-ol |
|---|---|
| PubChem CID | 11158327 |
| Molecular Formula | C40H72O6Si2 |
| Molecular Weight | 705.18 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | (2R,5S,8S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(2S,6R)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-4-methylideneoxan-2-yl]-5-methyl-4-methylidenedecan-2-ol |
| SMILES | C=C1C[C@H](CCOCc2ccc(OC)cc2)O[C@H](C[C@H](O)CC(=C)[C@@H](C)CC[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C40H72O6Si2/c1-30-25-37(21-23-43-29-33-16-19-35(42-10)20-17-33)45-38(26-30)28-34(41)27-32(3)31(2)15-18-36(46-48(13,14)40(7,8)9)22-24-44-47(11,12)39(4,5)6/h16-17,19-20,31,34,36-38,41H,1,3,15,18,21-29H2,2,4-14H3/t31-,34+,36-,37-,38-/m0/s1 |
| InChIKey | HIUOTZSIKYMKJI-OJDBQOGLSA-N |
| XLogP | 10.62 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.18 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|