C21H22ClF5N6O2 — CID 11168373
5-chloro-6-[2,6-difluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11168373) has the molecular formula C21H22ClF5N6O2 and a molecular weight of 520.89 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11168373 |
| Molecular Formula | C21H22ClF5N6O2 |
| Molecular Weight | 520.89 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCN3CCOCC3)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C21H22ClF5N6O2/c1-12(21(25,26)27)30-19-17(18(22)31-20-28-11-29-33(19)20)16-14(23)9-13(10-15(16)24)35-6-2-3-32-4-7-34-8-5-32/h9-12,30H,2-8H2,1H3/t12-/m0/s1 |
| InChIKey | QKXFUKJAICMMGW-LBPRGKRZSA-N |
| XLogP | 4.19 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|