C43H41O5PS — CID 11181588
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate (PubChem CID 11181588) has the molecular formula C43H41O5PS and a molecular weight of 700.84 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate |
|---|---|
| PubChem CID | 11181588 |
| Molecular Formula | C43H41O5PS |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@@H](OC(=O)C(C(=O)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C43H41O5PS/c1-42(2)33-28-29-43(42,31-50(46,47)37-26-16-7-17-27-37)38(30-33)48-41(45)40(39(44)32-18-8-3-9-19-32)49(34-20-10-4-11-21-34,35-22-12-5-13-23-35)36-24-14-6-15-25-36/h3-27,33,38H,28-31H2,1-2H3/t33-,38-,43-/m0/s1 |
| InChIKey | FTCGLZKYLMOYDQ-WTMYZBNZSA-N |
| XLogP | 7.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|