C36H36N8O4 — CID 11193052
tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(4-cyanoisoquinolin-1-yl)methyl]-2,6-dioxo-3-phenylpurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 11193052) has the molecular formula C36H36N8O4 and a molecular weight of 644.74 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(4-cyanoisoquinolin-1-yl)methyl]-2,6-dioxo-3-phenylpurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(4-cyanoisoquinolin-1-yl)methyl]-2,6-dioxo-3-phenylpurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 11193052 |
| Molecular Formula | C36H36N8O4 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(4-cyanoisoquinolin-1-yl)methyl]-2,6-dioxo-3-phenylpurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1ncc(C#N)c3ccccc13)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C36H36N8O4/c1-5-6-19-42-30-31(40-33(42)41-18-12-13-25(22-41)39-34(46)48-36(2,3)4)44(26-14-8-7-9-15-26)35(47)43(32(30)45)23-29-28-17-11-10-16-27(28)24(20-37)21-38-29/h7-11,14-17,21,25H,12-13,18-19,22-23H2,1-4H3,(H,39,46)/t25-/m1/s1 |
| InChIKey | WTPPDRBPJXGCKD-RUZDIDTESA-N |
| XLogP | 4.33 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|