C13H10ClN3O4S — CID 11233079
2-chloro-6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 11233079) has the molecular formula C13H10ClN3O4S and a molecular weight of 339.76 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 2-chloro-6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 11233079 |
| Molecular Formula | C13H10ClN3O4S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-chloro-6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1-c1cn2cc(Cl)sc2n1 |
| InChI | InChI=1S/C13H10ClN3O4S/c1-20-10-4-9(17(18)19)11(21-2)3-7(10)8-5-16-6-12(14)22-13(16)15-8/h3-6H,1-2H3 |
| InChIKey | UBWLOVIQKLKGQB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|