C28H38N2O3 — CID 11236295
(4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-4,6-bis(2-phenylethyl)-1,3-dioxan-5-imine (PubChem CID 11236295) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-4,6-bis(2-phenylethyl)-1,3-dioxan-5-imine.
| Compound Name | (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-4,6-bis(2-phenylethyl)-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 11236295 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-4,6-bis(2-phenylethyl)-1,3-dioxan-5-imine |
| SMILES | COC[C@@H]1CCCN1N=C1[C@H](CCc2ccccc2)OC(C)(C)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C28H38N2O3/c1-28(2)32-25(18-16-22-11-6-4-7-12-22)27(29-30-20-10-15-24(30)21-31-3)26(33-28)19-17-23-13-8-5-9-14-23/h4-9,11-14,24-26H,10,15-21H2,1-3H3/t24-,25-,26-/m0/s1 |
| InChIKey | IAZVJIVEMYYMFG-GSDHBNRESA-N |
| XLogP | 5.24 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|