C22H29N4O7P — CID 11237213
(1R,9R,10R)-10-[[[di(propan-2-yl)amino]-(4-nitrophenoxy)phosphanyl]oxymethyl]-4-methyl-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one (PubChem CID 11237213) has the molecular formula C22H29N4O7P and a molecular weight of 492.47 g/mol. Its IUPAC name is (1R,9R,10R)-10-[[[di(propan-2-yl)amino]-(4-nitrophenoxy)phosphanyl]oxymethyl]-4-methyl-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one.
| Compound Name | (1R,9R,10R)-10-[[[di(propan-2-yl)amino]-(4-nitrophenoxy)phosphanyl]oxymethyl]-4-methyl-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one |
|---|---|
| PubChem CID | 11237213 |
| Molecular Formula | C22H29N4O7P |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (1R,9R,10R)-10-[[[di(propan-2-yl)amino]-(4-nitrophenoxy)phosphanyl]oxymethyl]-4-methyl-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-5-one |
| SMILES | Cc1cn2c(nc1=O)O[C@@H]1C[C@H]2O[C@@H]1COP(Oc1ccc([N+](=O)[O-])cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H29N4O7P/c1-13(2)25(14(3)4)34(33-17-8-6-16(7-9-17)26(28)29)30-12-19-18-10-20(31-19)24-11-15(5)21(27)23-22(24)32-18/h6-9,11,13-14,18-20H,10,12H2,1-5H3/t18-,19-,20-,34?/m1/s1 |
| InChIKey | HVZKJVCUHGTZMV-WPLCJKBUSA-N |
| XLogP | 3.95 |
| TPSA | 118.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|