C10H8Cl3OP — CID 11243005
[(1E,3E)-3-chloro-4-dichlorophosphorylbuta-1,3-dienyl]benzene (PubChem CID 11243005) has the molecular formula C10H8Cl3OP and a molecular weight of 281.51 g/mol. Its IUPAC name is [(1E,3E)-3-chloro-4-dichlorophosphorylbuta-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-3-chloro-4-dichlorophosphorylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 11243005 |
| Molecular Formula | C10H8Cl3OP |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | [(1E,3E)-3-chloro-4-dichlorophosphorylbuta-1,3-dienyl]benzene |
| SMILES | O=P(Cl)(Cl)/C=C(Cl)\C=C\c1ccccc1 |
| InChI | InChI=1S/C10H8Cl3OP/c11-10(8-15(12,13)14)7-6-9-4-2-1-3-5-9/h1-8H/b7-6+,10-8+ |
| InChIKey | SWTFTZHBMVKKMU-LQPGMRSMSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|