C10H8Cl4P+ — CID 11353285
trichloro-[(1E,3E)-2-chloro-4-phenylbuta-1,3-dienyl]phosphanium (PubChem CID 11353285) has the molecular formula C10H8Cl4P+ and a molecular weight of 300.96 g/mol. Its IUPAC name is trichloro-[(1E,3E)-2-chloro-4-phenylbuta-1,3-dienyl]phosphanium.
| Compound Name | trichloro-[(1E,3E)-2-chloro-4-phenylbuta-1,3-dienyl]phosphanium |
|---|---|
| PubChem CID | 11353285 |
| Molecular Formula | C10H8Cl4P+ |
| Molecular Weight | 300.96 g/mol |
| Exact Mass | 298.91 |
| IUPAC Name | trichloro-[(1E,3E)-2-chloro-4-phenylbuta-1,3-dienyl]phosphanium |
| SMILES | ClC(/C=C/c1ccccc1)=C/[P+](Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8Cl4P/c11-10(8-15(12,13)14)7-6-9-4-2-1-3-5-9/h1-8H/q+1/b7-6+,10-8+ |
| InChIKey | VXXPSPNGPDVLGR-LQPGMRSMSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|